C10H7F2NO4 — CID 171870810
4-(2-cyano-1,2-dihydroxyethyl)-2,6-difluorobenzoic acid (PubChem CID 171870810) has the molecular formula C10H7F2NO4 and a molecular weight of 243.16 g/mol. Its IUPAC name is 4-(2-cyano-1,2-dihydroxyethyl)-2,6-difluorobenzoic acid.
| Compound Name | 4-(2-cyano-1,2-dihydroxyethyl)-2,6-difluorobenzoic acid |
|---|---|
| PubChem CID | 171870810 |
| Molecular Formula | C10H7F2NO4 |
| Molecular Weight | 243.16 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | 4-(2-cyano-1,2-dihydroxyethyl)-2,6-difluorobenzoic acid |
| SMILES | N#CC(O)C(O)c1cc(F)c(C(=O)O)c(F)c1 |
| InChI | InChI=1S/C10H7F2NO4/c11-5-1-4(9(15)7(14)3-13)2-6(12)8(5)10(16)17/h1-2,7,9,14-15H,(H,16,17) |
| InChIKey | YLEQKAUYYIOLSR-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.16 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|