C17H25NO2 — CID 171871434
3-(3,5-ditert-butylphenyl)-2,3-dihydroxypropanenitrile (PubChem CID 171871434) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is 3-(3,5-ditert-butylphenyl)-2,3-dihydroxypropanenitrile.
| Compound Name | 3-(3,5-ditert-butylphenyl)-2,3-dihydroxypropanenitrile |
|---|---|
| PubChem CID | 171871434 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 3-(3,5-ditert-butylphenyl)-2,3-dihydroxypropanenitrile |
| SMILES | CC(C)(C)c1cc(C(O)C(O)C#N)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C17H25NO2/c1-16(2,3)12-7-11(15(20)14(19)10-18)8-13(9-12)17(4,5)6/h7-9,14-15,19-20H,1-6H3 |
| InChIKey | CKSZQKYQKNMKLI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|