C17H28O2S — CID 170821080
1-(3,5-ditert-butylphenyl)-3-sulfanylpropane-1,2-diol (PubChem CID 170821080) has the molecular formula C17H28O2S and a molecular weight of 296.48 g/mol. Its IUPAC name is 1-(3,5-ditert-butylphenyl)-3-sulfanylpropane-1,2-diol.
| Compound Name | 1-(3,5-ditert-butylphenyl)-3-sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 170821080 |
| Molecular Formula | C17H28O2S |
| Molecular Weight | 296.48 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 1-(3,5-ditert-butylphenyl)-3-sulfanylpropane-1,2-diol |
| SMILES | CC(C)(C)c1cc(C(O)C(O)CS)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C17H28O2S/c1-16(2,3)12-7-11(15(19)14(18)10-20)8-13(9-12)17(4,5)6/h7-9,14-15,18-20H,10H2,1-6H3 |
| InChIKey | RRZVVDCFTAPKLQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|