C11H12O6S — CID 170820725
5-(1,2-dihydroxy-3-sulfanylpropyl)benzene-1,3-dicarboxylic acid (PubChem CID 170820725) has the molecular formula C11H12O6S and a molecular weight of 272.28 g/mol. Its IUPAC name is 5-(1,2-dihydroxy-3-sulfanylpropyl)benzene-1,3-dicarboxylic acid.
| Compound Name | 5-(1,2-dihydroxy-3-sulfanylpropyl)benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 170820725 |
| Molecular Formula | C11H12O6S |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 5-(1,2-dihydroxy-3-sulfanylpropyl)benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)cc(C(O)C(O)CS)c1 |
| InChI | InChI=1S/C11H12O6S/c12-8(4-18)9(13)5-1-6(10(14)15)3-7(2-5)11(16)17/h1-3,8-9,12-13,18H,4H2,(H,14,15)(H,16,17) |
| InChIKey | KTOXERDPVXZJOG-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|