3-(3-amino-1,2-dihydroxypropyl)-5-chlorobenzoic acid

C10H12ClNO4 — CID 170828294

IUPAC3-(3-amino-1,2-dihydroxypropyl)-5-chlorobenzoic acid
SMILESNCC(O)C(O)c1cc(Cl)cc(C(=O)O)c1
InChIInChI=1S/C10H12ClNO4/c11-7-2-5(9(14)8(13)4-12)1-6(3-7)10(15)16/h1-3,8-9,13-14H,4,12H2,(H,15,16)
InChIKeyUINCJGZYFDKALT-UHFFFAOYSA-N
MW245.66 g/mol
LogP0.39
Rot. Bonds4

About 3-(3-amino-1,2-dihydroxypropyl)-5-chlorobenzoic acid

3-(3-amino-1,2-dihydroxypropyl)-5-chlorobenzoic acid (PubChem CID 170828294) has the molecular formula C10H12ClNO4 and a molecular weight of 245.66 g/mol. Its IUPAC name is 3-(3-amino-1,2-dihydroxypropyl)-5-chlorobenzoic acid.

Molecular Properties

Compound Name3-(3-amino-1,2-dihydroxypropyl)-5-chlorobenzoic acid
PubChem CID170828294
Molecular FormulaC10H12ClNO4
Molecular Weight245.66 g/mol
Exact Mass245.05
IUPAC Name3-(3-amino-1,2-dihydroxypropyl)-5-chlorobenzoic acid
SMILESNCC(O)C(O)c1cc(Cl)cc(C(=O)O)c1
InChIInChI=1S/C10H12ClNO4/c11-7-2-5(9(14)8(13)4-12)1-6(3-7)10(15)16/h1-3,8-9,13-14H,4,12H2,(H,15,16)
InChIKeyUINCJGZYFDKALT-UHFFFAOYSA-N
XLogP0.39
TPSA103.78 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500245.66
LogP ≤ 50.39
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze 3-(3-amino-1,2-dihydroxypropyl)-5-chlorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(3-amino-1,2-dihydroxypropyl)-5-chlorobenzoic acid?
The IUPAC name of 3-(3-amino-1,2-dihydroxypropyl)-5-chlorobenzoic acid (CID 170828294) is 3-(3-amino-1,2-dihydroxypropyl)-5-chlorobenzoic acid.
What is the SMILES notation for 3-(3-amino-1,2-dihydroxypropyl)-5-chlorobenzoic acid?
The canonical SMILES for 3-(3-amino-1,2-dihydroxypropyl)-5-chlorobenzoic acid is NCC(O)C(O)c1cc(Cl)cc(C(=O)O)c1.
What is the InChIKey of 3-(3-amino-1,2-dihydroxypropyl)-5-chlorobenzoic acid?
The InChIKey is UINCJGZYFDKALT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClNO4/c11-7-2-5(9(14)8(13)4-12)1-6(3-7)10(15)16/h1-3,8-9,13-14H,4,12H2,(H,15,16).
What are the key properties of 3-(3-amino-1,2-dihydroxypropyl)-5-chlorobenzoic acid?
3-(3-amino-1,2-dihydroxypropyl)-5-chlorobenzoic acid has a molecular weight of 245.66 g/mol, XLogP of 0.39, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-amino-1,2-dihydroxypropyl)-5-chlorobenzoic acid is sourced from PubChem (CID 170828294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).