C8H11NO4S — CID 170827639
5-(3-amino-1,2-dihydroxypropyl)thiophene-3-carboxylic acid (PubChem CID 170827639) has the molecular formula C8H11NO4S and a molecular weight of 217.25 g/mol. Its IUPAC name is 5-(3-amino-1,2-dihydroxypropyl)thiophene-3-carboxylic acid.
| Compound Name | 5-(3-amino-1,2-dihydroxypropyl)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 170827639 |
| Molecular Formula | C8H11NO4S |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 5-(3-amino-1,2-dihydroxypropyl)thiophene-3-carboxylic acid |
| SMILES | NCC(O)C(O)c1cc(C(=O)O)cs1 |
| InChI | InChI=1S/C8H11NO4S/c9-2-5(10)7(11)6-1-4(3-14-6)8(12)13/h1,3,5,7,10-11H,2,9H2,(H,12,13) |
| InChIKey | AWIRLDDVDMWNAG-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |