About 4-(3-amino-1,2-dihydroxypropyl)thiophene-2-carbaldehyde
4-(3-amino-1,2-dihydroxypropyl)thiophene-2-carbaldehyde (PubChem CID 170827495) has the molecular formula C8H11NO3S
and a molecular weight of 201.25 g/mol. Its IUPAC name is 4-(3-amino-1,2-dihydroxypropyl)thiophene-2-carbaldehyde.
Molecular Properties
| Compound Name | 4-(3-amino-1,2-dihydroxypropyl)thiophene-2-carbaldehyde |
| PubChem CID | 170827495 |
| Molecular Formula | C8H11NO3S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.05 |
| IUPAC Name | 4-(3-amino-1,2-dihydroxypropyl)thiophene-2-carbaldehyde |
| SMILES | NCC(O)C(O)c1csc(C=O)c1 |
| InChI | InChI=1S/C8H11NO3S/c9-2-7(11)8(12)5-1-6(3-10)13-4-5/h1,3-4,7-8,11-12H,2,9H2 |
| InChIKey | PIHPVHRHHOFHLA-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-amino-1,2-dihydroxypropyl)thiophene-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-amino-1,2-dihydroxypropyl)thiophene-2-carbaldehyde?
The IUPAC name of 4-(3-amino-1,2-dihydroxypropyl)thiophene-2-carbaldehyde (CID 170827495) is 4-(3-amino-1,2-dihydroxypropyl)thiophene-2-carbaldehyde.
What is the SMILES notation for 4-(3-amino-1,2-dihydroxypropyl)thiophene-2-carbaldehyde?
The canonical SMILES for 4-(3-amino-1,2-dihydroxypropyl)thiophene-2-carbaldehyde is NCC(O)C(O)c1csc(C=O)c1.
What is the InChIKey of 4-(3-amino-1,2-dihydroxypropyl)thiophene-2-carbaldehyde?
The InChIKey is PIHPVHRHHOFHLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO3S/c9-2-7(11)8(12)5-1-6(3-10)13-4-5/h1,3-4,7-8,11-12H,2,9H2.
What are the key properties of 4-(3-amino-1,2-dihydroxypropyl)thiophene-2-carbaldehyde?
4-(3-amino-1,2-dihydroxypropyl)thiophene-2-carbaldehyde has a molecular weight of 201.25 g/mol, XLogP of -0.09, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-amino-1,2-dihydroxypropyl)thiophene-2-carbaldehyde is sourced from PubChem (CID 170827495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).