C13H19NO5S — CID 170831544
tert-butyl N-[3-(5-formylthiophen-3-yl)-2,3-dihydroxypropyl]carbamate (PubChem CID 170831544) has the molecular formula C13H19NO5S and a molecular weight of 301.36 g/mol. Its IUPAC name is tert-butyl N-[3-(5-formylthiophen-3-yl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | tert-butyl N-[3-(5-formylthiophen-3-yl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 170831544 |
| Molecular Formula | C13H19NO5S |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | tert-butyl N-[3-(5-formylthiophen-3-yl)-2,3-dihydroxypropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(O)C(O)c1csc(C=O)c1 |
| InChI | InChI=1S/C13H19NO5S/c1-13(2,3)19-12(18)14-5-10(16)11(17)8-4-9(6-15)20-7-8/h4,6-7,10-11,16-17H,5H2,1-3H3,(H,14,18) |
| InChIKey | WRIDMGNZPUCFDH-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|