C15H20BrNO5 — CID 170833337
tert-butyl N-[3-(3-bromo-5-formylphenyl)-2,3-dihydroxypropyl]carbamate (PubChem CID 170833337) has the molecular formula C15H20BrNO5 and a molecular weight of 374.23 g/mol. Its IUPAC name is tert-butyl N-[3-(3-bromo-5-formylphenyl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | tert-butyl N-[3-(3-bromo-5-formylphenyl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 170833337 |
| Molecular Formula | C15H20BrNO5 |
| Molecular Weight | 374.23 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | tert-butyl N-[3-(3-bromo-5-formylphenyl)-2,3-dihydroxypropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(O)C(O)c1cc(Br)cc(C=O)c1 |
| InChI | InChI=1S/C15H20BrNO5/c1-15(2,3)22-14(21)17-7-12(19)13(20)10-4-9(8-18)5-11(16)6-10/h4-6,8,12-13,19-20H,7H2,1-3H3,(H,17,21) |
| InChIKey | XLOOQNYFTPHCGY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.23 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|