C12H18N2O5S — CID 170831615
tert-butyl N-[3-(4-formyl-1,3-thiazol-2-yl)-2,3-dihydroxypropyl]carbamate (PubChem CID 170831615) has the molecular formula C12H18N2O5S and a molecular weight of 302.35 g/mol. Its IUPAC name is tert-butyl N-[3-(4-formyl-1,3-thiazol-2-yl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | tert-butyl N-[3-(4-formyl-1,3-thiazol-2-yl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 170831615 |
| Molecular Formula | C12H18N2O5S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | tert-butyl N-[3-(4-formyl-1,3-thiazol-2-yl)-2,3-dihydroxypropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(O)C(O)c1nc(C=O)cs1 |
| InChI | InChI=1S/C12H18N2O5S/c1-12(2,3)19-11(18)13-4-8(16)9(17)10-14-7(5-15)6-20-10/h5-6,8-9,16-17H,4H2,1-3H3,(H,13,18) |
| InChIKey | MXYHNGGOLXIOOI-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|