About methyl 3-(4-formyl-1,3-thiazol-2-yl)-2,3-dihydroxypropanoate
methyl 3-(4-formyl-1,3-thiazol-2-yl)-2,3-dihydroxypropanoate (PubChem CID 171863576) has the molecular formula C8H9NO5S
and a molecular weight of 231.23 g/mol. Its IUPAC name is methyl 3-(4-formyl-1,3-thiazol-2-yl)-2,3-dihydroxypropanoate.
Molecular Properties
| Compound Name | methyl 3-(4-formyl-1,3-thiazol-2-yl)-2,3-dihydroxypropanoate |
| PubChem CID | 171863576 |
| Molecular Formula | C8H9NO5S |
| Molecular Weight | 231.23 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | methyl 3-(4-formyl-1,3-thiazol-2-yl)-2,3-dihydroxypropanoate |
| SMILES | COC(=O)C(O)C(O)c1nc(C=O)cs1 |
| InChI | InChI=1S/C8H9NO5S/c1-14-8(13)6(12)5(11)7-9-4(2-10)3-15-7/h2-3,5-6,11-12H,1H3 |
| InChIKey | LWEOKQFGKATMOW-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.23 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-(4-formyl-1,3-thiazol-2-yl)-2,3-dihydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(4-formyl-1,3-thiazol-2-yl)-2,3-dihydroxypropanoate?
The IUPAC name of methyl 3-(4-formyl-1,3-thiazol-2-yl)-2,3-dihydroxypropanoate (CID 171863576) is methyl 3-(4-formyl-1,3-thiazol-2-yl)-2,3-dihydroxypropanoate.
What is the SMILES notation for methyl 3-(4-formyl-1,3-thiazol-2-yl)-2,3-dihydroxypropanoate?
The canonical SMILES for methyl 3-(4-formyl-1,3-thiazol-2-yl)-2,3-dihydroxypropanoate is COC(=O)C(O)C(O)c1nc(C=O)cs1.
What is the InChIKey of methyl 3-(4-formyl-1,3-thiazol-2-yl)-2,3-dihydroxypropanoate?
The InChIKey is LWEOKQFGKATMOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO5S/c1-14-8(13)6(12)5(11)7-9-4(2-10)3-15-7/h2-3,5-6,11-12H,1H3.
What are the key properties of methyl 3-(4-formyl-1,3-thiazol-2-yl)-2,3-dihydroxypropanoate?
methyl 3-(4-formyl-1,3-thiazol-2-yl)-2,3-dihydroxypropanoate has a molecular weight of 231.23 g/mol, XLogP of -0.48, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(4-formyl-1,3-thiazol-2-yl)-2,3-dihydroxypropanoate is sourced from PubChem (CID 171863576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).