C8H9NO5S — CID 171863576
methyl 3-(4-formyl-1,3-thiazol-2-yl)-2,3-dihydroxypropanoate (PubChem CID 171863576) has the molecular formula C8H9NO5S and a molecular weight of 231.23 g/mol. Its IUPAC name is methyl 3-(4-formyl-1,3-thiazol-2-yl)-2,3-dihydroxypropanoate.
| Compound Name | methyl 3-(4-formyl-1,3-thiazol-2-yl)-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 171863576 |
| Molecular Formula | C8H9NO5S |
| Molecular Weight | 231.23 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | methyl 3-(4-formyl-1,3-thiazol-2-yl)-2,3-dihydroxypropanoate |
| SMILES | COC(=O)C(O)C(O)c1nc(C=O)cs1 |
| InChI | InChI=1S/C8H9NO5S/c1-14-8(13)6(12)5(11)7-9-4(2-10)3-15-7/h2-3,5-6,11-12H,1H3 |
| InChIKey | LWEOKQFGKATMOW-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.23 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|