C13H20N2O3S — CID 146691205
[(1R,3R)-1-(4-formyl-1,3-thiazol-2-yl)-4-methyl-3-(methylamino)pentyl] acetate (PubChem CID 146691205) has the molecular formula C13H20N2O3S and a molecular weight of 284.38 g/mol. Its IUPAC name is [(1R,3R)-1-(4-formyl-1,3-thiazol-2-yl)-4-methyl-3-(methylamino)pentyl] acetate.
| Compound Name | [(1R,3R)-1-(4-formyl-1,3-thiazol-2-yl)-4-methyl-3-(methylamino)pentyl] acetate |
|---|---|
| PubChem CID | 146691205 |
| Molecular Formula | C13H20N2O3S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | [(1R,3R)-1-(4-formyl-1,3-thiazol-2-yl)-4-methyl-3-(methylamino)pentyl] acetate |
| SMILES | CN[C@H](C[C@@H](OC(C)=O)c1nc(C=O)cs1)C(C)C |
| InChI | InChI=1S/C13H20N2O3S/c1-8(2)11(14-4)5-12(18-9(3)17)13-15-10(6-16)7-19-13/h6-8,11-12,14H,5H2,1-4H3/t11-,12-/m1/s1 |
| InChIKey | QIMGLCHKHZYHQD-VXGBXAGGSA-N |
| XLogP | 2.19 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|