C22H36N2O5S — CID 154959418
[1-(4-formyl-1,3-thiazol-2-yl)-4-methyl-3-[pentanoyl(pentoxy)amino]pentyl] acetate (PubChem CID 154959418) has the molecular formula C22H36N2O5S and a molecular weight of 440.61 g/mol. Its IUPAC name is [1-(4-formyl-1,3-thiazol-2-yl)-4-methyl-3-[pentanoyl(pentoxy)amino]pentyl] acetate.
| Compound Name | [1-(4-formyl-1,3-thiazol-2-yl)-4-methyl-3-[pentanoyl(pentoxy)amino]pentyl] acetate |
|---|---|
| PubChem CID | 154959418 |
| Molecular Formula | C22H36N2O5S |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | [1-(4-formyl-1,3-thiazol-2-yl)-4-methyl-3-[pentanoyl(pentoxy)amino]pentyl] acetate |
| SMILES | CCCCCON(C(=O)CCCC)C(CC(OC(C)=O)c1nc(C=O)cs1)C(C)C |
| InChI | InChI=1S/C22H36N2O5S/c1-6-8-10-12-28-24(21(27)11-9-7-2)19(16(3)4)13-20(29-17(5)26)22-23-18(14-25)15-30-22/h14-16,19-20H,6-13H2,1-5H3 |
| InChIKey | QGAOOMXCBIDTBE-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|