C31H47N3O7S — CID 168969116
4-[[2-[1-acetyloxy-4-methyl-3-[methyl(pentoxy)amino]pentyl]-1,3-thiazole-4-carbonyl]amino]-5-(4-hydroxyphenyl)-2,2-dimethylpentanoic acid (PubChem CID 168969116) has the molecular formula C31H47N3O7S and a molecular weight of 605.80 g/mol. Its IUPAC name is 4-[[2-[1-acetyloxy-4-methyl-3-[methyl(pentoxy)amino]pentyl]-1,3-thiazole-4-carbonyl]amino]-5-(4-hydroxyphenyl)-2,2-dimethylpentanoic acid.
| Compound Name | 4-[[2-[1-acetyloxy-4-methyl-3-[methyl(pentoxy)amino]pentyl]-1,3-thiazole-4-carbonyl]amino]-5-(4-hydroxyphenyl)-2,2-dimethylpentanoic acid |
|---|---|
| PubChem CID | 168969116 |
| Molecular Formula | C31H47N3O7S |
| Molecular Weight | 605.80 g/mol |
| Exact Mass | 605.31 |
| IUPAC Name | 4-[[2-[1-acetyloxy-4-methyl-3-[methyl(pentoxy)amino]pentyl]-1,3-thiazole-4-carbonyl]amino]-5-(4-hydroxyphenyl)-2,2-dimethylpentanoic acid |
| SMILES | CCCCCON(C)C(CC(OC(C)=O)c1nc(C(=O)NC(Cc2ccc(O)cc2)CC(C)(C)C(=O)O)cs1)C(C)C |
| InChI | InChI=1S/C31H47N3O7S/c1-8-9-10-15-40-34(7)26(20(2)3)17-27(41-21(4)35)29-33-25(19-42-29)28(37)32-23(18-31(5,6)30(38)39)16-22-11-13-24(36)14-12-22/h11-14,19-20,23,26-27,36H,8-10,15-18H2,1-7H3,(H,32,37)(H,38,39) |
| InChIKey | BSSAHDMGQIIVGM-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 138.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.80 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|