C36H56N4O6S — CID 154959336
4-[[2-[1-acetyloxy-3-[hexyl(pentanoyl)amino]-4-methylpentyl]-1,3-thiazole-4-carbonyl]amino]-5-(4-aminophenyl)-2,2-dimethylpentanoic acid (PubChem CID 154959336) has the molecular formula C36H56N4O6S and a molecular weight of 672.93 g/mol. Its IUPAC name is 4-[[2-[1-acetyloxy-3-[hexyl(pentanoyl)amino]-4-methylpentyl]-1,3-thiazole-4-carbonyl]amino]-5-(4-aminophenyl)-2,2-dimethylpentanoic acid.
| Compound Name | 4-[[2-[1-acetyloxy-3-[hexyl(pentanoyl)amino]-4-methylpentyl]-1,3-thiazole-4-carbonyl]amino]-5-(4-aminophenyl)-2,2-dimethylpentanoic acid |
|---|---|
| PubChem CID | 154959336 |
| Molecular Formula | C36H56N4O6S |
| Molecular Weight | 672.93 g/mol |
| Exact Mass | 672.39 |
| IUPAC Name | 4-[[2-[1-acetyloxy-3-[hexyl(pentanoyl)amino]-4-methylpentyl]-1,3-thiazole-4-carbonyl]amino]-5-(4-aminophenyl)-2,2-dimethylpentanoic acid |
| SMILES | CCCCCCN(C(=O)CCCC)C(CC(OC(C)=O)c1nc(C(=O)NC(Cc2ccc(N)cc2)CC(C)(C)C(=O)O)cs1)C(C)C |
| InChI | InChI=1S/C36H56N4O6S/c1-8-10-12-13-19-40(32(42)14-11-9-2)30(24(3)4)21-31(46-25(5)41)34-39-29(23-47-34)33(43)38-28(22-36(6,7)35(44)45)20-26-15-17-27(37)18-16-26/h15-18,23-24,28,30-31H,8-14,19-22,37H2,1-7H3,(H,38,43)(H,44,45) |
| InChIKey | FKTIYJSJMZQQLQ-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 151.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.93 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|