C32H49N5O6S — CID 144685327
5-(4-aminophenyl)-2-methyl-4-[[2-[4-methyl-1-(methylcarbamoyloxy)-3-[pentanoyl(propyl)amino]pentyl]-1,3-thiazole-4-carbonyl]amino]pentanoic acid (PubChem CID 144685327) has the molecular formula C32H49N5O6S and a molecular weight of 631.84 g/mol. Its IUPAC name is 5-(4-aminophenyl)-2-methyl-4-[[2-[4-methyl-1-(methylcarbamoyloxy)-3-[pentanoyl(propyl)amino]pentyl]-1,3-thiazole-4-carbonyl]amino]pentanoic acid.
| Compound Name | 5-(4-aminophenyl)-2-methyl-4-[[2-[4-methyl-1-(methylcarbamoyloxy)-3-[pentanoyl(propyl)amino]pentyl]-1,3-thiazole-4-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 144685327 |
| Molecular Formula | C32H49N5O6S |
| Molecular Weight | 631.84 g/mol |
| Exact Mass | 631.34 |
| IUPAC Name | 5-(4-aminophenyl)-2-methyl-4-[[2-[4-methyl-1-(methylcarbamoyloxy)-3-[pentanoyl(propyl)amino]pentyl]-1,3-thiazole-4-carbonyl]amino]pentanoic acid |
| SMILES | CCCCC(=O)N(CCC)C(CC(OC(=O)NC)c1nc(C(=O)NC(Cc2ccc(N)cc2)CC(C)C(=O)O)cs1)C(C)C |
| InChI | InChI=1S/C32H49N5O6S/c1-7-9-10-28(38)37(15-8-2)26(20(3)4)18-27(43-32(42)34-6)30-36-25(19-44-30)29(39)35-24(16-21(5)31(40)41)17-22-11-13-23(33)14-12-22/h11-14,19-21,24,26-27H,7-10,15-18,33H2,1-6H3,(H,34,42)(H,35,39)(H,40,41) |
| InChIKey | ZZNISLPMKUJVCT-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 163.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.84 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|