C36H58N4O5S — CID 170005846
(4S)-5-(4-aminophenyl)-4-[[2-[(1R,3R)-1-ethoxy-3-[hexyl(pentanoyl)amino]-4-methylpentyl]-1,3-thiazole-4-carbonyl]amino]-2,2-dimethylpentanoic acid (PubChem CID 170005846) has the molecular formula C36H58N4O5S and a molecular weight of 658.95 g/mol. Its IUPAC name is (4S)-5-(4-aminophenyl)-4-[[2-[(1R,3R)-1-ethoxy-3-[hexyl(pentanoyl)amino]-4-methylpentyl]-1,3-thiazole-4-carbonyl]amino]-2,2-dimethylpentanoic acid.
| Compound Name | (4S)-5-(4-aminophenyl)-4-[[2-[(1R,3R)-1-ethoxy-3-[hexyl(pentanoyl)amino]-4-methylpentyl]-1,3-thiazole-4-carbonyl]amino]-2,2-dimethylpentanoic acid |
|---|---|
| PubChem CID | 170005846 |
| Molecular Formula | C36H58N4O5S |
| Molecular Weight | 658.95 g/mol |
| Exact Mass | 658.41 |
| IUPAC Name | (4S)-5-(4-aminophenyl)-4-[[2-[(1R,3R)-1-ethoxy-3-[hexyl(pentanoyl)amino]-4-methylpentyl]-1,3-thiazole-4-carbonyl]amino]-2,2-dimethylpentanoic acid |
| SMILES | CCCCCCN(C(=O)CCCC)[C@H](C[C@@H](OCC)c1nc(C(=O)N[C@@H](Cc2ccc(N)cc2)CC(C)(C)C(=O)O)cs1)C(C)C |
| InChI | InChI=1S/C36H58N4O5S/c1-8-11-13-14-20-40(32(41)15-12-9-2)30(25(4)5)22-31(45-10-3)34-39-29(24-46-34)33(42)38-28(23-36(6,7)35(43)44)21-26-16-18-27(37)19-17-26/h16-19,24-25,28,30-31H,8-15,20-23,37H2,1-7H3,(H,38,42)(H,43,44)/t28-,30+,31+/m0/s1 |
| InChIKey | BJOCQXITUNSBRE-FAOMPSFFSA-N |
| XLogP | 7.66 |
| TPSA | 134.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.95 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|