C28H42B2N4O8S2 — CID 157375778
CID 157375778 (PubChem CID 157375778) has the molecular formula C28H42B2N4O8S2 and a molecular weight of 648.42 g/mol.
| Compound Name | CID 157375778 |
|---|---|
| PubChem CID | 157375778 |
| Molecular Formula | C28H42B2N4O8S2 |
| Molecular Weight | 648.42 g/mol |
| Exact Mass | 648.26 |
| IUPAC Name | — |
| SMILES | CC(=O)O[C@@H](C[C@H](C(C)C)N(C)[B]C=O)c1nc(C(=O)O)cs1.CC(=O)O[C@H](C[C@@H](C(C)C)N(C)[B]C=O)c1nc(C)cs1 |
| InChI | InChI=1S/C14H20BN2O5S.C14H22BN2O3S/c1-8(2)11(17(4)15-7-18)5-12(22-9(3)19)13-16-10(6-23-13)14(20)21;1-9(2)12(17(5)15-8-18)6-13(20-11(4)19)14-16-10(3)7-21-14/h6-8,11-12H,5H2,1-4H3,(H,20,21);7-9,12-13H,6H2,1-5H3/t11-,12+;12-,13+/m10/s1 |
| InChIKey | YVRJKZPSVVTTEW-OMUINHBFSA-N |
| XLogP | 3.81 |
| TPSA | 156.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|