C24H38B2N4O6S2 — CID 167643546
CID 167643546 (PubChem CID 167643546) has the molecular formula C24H38B2N4O6S2 and a molecular weight of 564.35 g/mol.
| Compound Name | CID 167643546 |
|---|---|
| PubChem CID | 167643546 |
| Molecular Formula | C24H38B2N4O6S2 |
| Molecular Weight | 564.35 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | — |
| SMILES | CC(C)C(C[C@H](O)c1nc(C(=O)O)cs1)N(C)[B]C=O.Cc1csc([C@H](O)C[C@@H](C(C)C)N(C)[B]C=O)n1 |
| InChI | InChI=1S/C12H18BN2O4S.C12H20BN2O2S/c1-7(2)9(15(3)13-6-16)4-10(17)11-14-8(5-20-11)12(18)19;1-8(2)10(15(4)13-7-16)5-11(17)12-14-9(3)6-18-12/h5-7,9-10,17H,4H2,1-3H3,(H,18,19);6-8,10-11,17H,5H2,1-4H3/t9?,10-;10-,11+/m00/s1 |
| InChIKey | JSRZEHKBNOONOF-STOSLFPMSA-N |
| XLogP | 2.67 |
| TPSA | 144.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|