C8H10BrNO4S — CID 171860069
methyl 2-(3-bromo-1,2-dihydroxypropyl)-1,3-thiazole-4-carboxylate (PubChem CID 171860069) has the molecular formula C8H10BrNO4S and a molecular weight of 296.14 g/mol. Its IUPAC name is methyl 2-(3-bromo-1,2-dihydroxypropyl)-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-(3-bromo-1,2-dihydroxypropyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 171860069 |
| Molecular Formula | C8H10BrNO4S |
| Molecular Weight | 296.14 g/mol |
| Exact Mass | 294.95 |
| IUPAC Name | methyl 2-(3-bromo-1,2-dihydroxypropyl)-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1csc(C(O)C(O)CBr)n1 |
| InChI | InChI=1S/C8H10BrNO4S/c1-14-8(13)4-3-15-7(10-4)6(12)5(11)2-9/h3,5-6,11-12H,2H2,1H3 |
| InChIKey | QIJKELJIXRTXGS-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.14 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|