C10H15NO4S2 — CID 171874528
ethyl 2-(1,2-dihydroxy-4-sulfanylbutyl)-1,3-thiazole-4-carboxylate (PubChem CID 171874528) has the molecular formula C10H15NO4S2 and a molecular weight of 277.37 g/mol. Its IUPAC name is ethyl 2-(1,2-dihydroxy-4-sulfanylbutyl)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-(1,2-dihydroxy-4-sulfanylbutyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 171874528 |
| Molecular Formula | C10H15NO4S2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | ethyl 2-(1,2-dihydroxy-4-sulfanylbutyl)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(C(O)C(O)CCS)n1 |
| InChI | InChI=1S/C10H15NO4S2/c1-2-15-10(14)6-5-17-9(11-6)8(13)7(12)3-4-16/h5,7-8,12-13,16H,2-4H2,1H3 |
| InChIKey | NJPXGAFMXBNGRL-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|