About methyl 2-(1,2-dihydroxy-4-sulfanylbutyl)-1,3-thiazole-4-carboxylate
methyl 2-(1,2-dihydroxy-4-sulfanylbutyl)-1,3-thiazole-4-carboxylate (PubChem CID 171874179) has the molecular formula C9H13NO4S2
and a molecular weight of 263.34 g/mol. Its IUPAC name is methyl 2-(1,2-dihydroxy-4-sulfanylbutyl)-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 2-(1,2-dihydroxy-4-sulfanylbutyl)-1,3-thiazole-4-carboxylate |
| PubChem CID | 171874179 |
| Molecular Formula | C9H13NO4S2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | methyl 2-(1,2-dihydroxy-4-sulfanylbutyl)-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1csc(C(O)C(O)CCS)n1 |
| InChI | InChI=1S/C9H13NO4S2/c1-14-9(13)5-4-16-8(10-5)7(12)6(11)2-3-15/h4,6-7,11-12,15H,2-3H2,1H3 |
| InChIKey | SSOBCWFAVKNEFB-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(1,2-dihydroxy-4-sulfanylbutyl)-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(1,2-dihydroxy-4-sulfanylbutyl)-1,3-thiazole-4-carboxylate?
The IUPAC name of methyl 2-(1,2-dihydroxy-4-sulfanylbutyl)-1,3-thiazole-4-carboxylate (CID 171874179) is methyl 2-(1,2-dihydroxy-4-sulfanylbutyl)-1,3-thiazole-4-carboxylate.
What is the SMILES notation for methyl 2-(1,2-dihydroxy-4-sulfanylbutyl)-1,3-thiazole-4-carboxylate?
The canonical SMILES for methyl 2-(1,2-dihydroxy-4-sulfanylbutyl)-1,3-thiazole-4-carboxylate is COC(=O)c1csc(C(O)C(O)CCS)n1.
What is the InChIKey of methyl 2-(1,2-dihydroxy-4-sulfanylbutyl)-1,3-thiazole-4-carboxylate?
The InChIKey is SSOBCWFAVKNEFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO4S2/c1-14-9(13)5-4-16-8(10-5)7(12)6(11)2-3-15/h4,6-7,11-12,15H,2-3H2,1H3.
What are the key properties of methyl 2-(1,2-dihydroxy-4-sulfanylbutyl)-1,3-thiazole-4-carboxylate?
methyl 2-(1,2-dihydroxy-4-sulfanylbutyl)-1,3-thiazole-4-carboxylate has a molecular weight of 263.34 g/mol, XLogP of 0.64, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(1,2-dihydroxy-4-sulfanylbutyl)-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 171874179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).