C12H17NO5S2 — CID 171876320
ethyl 2-(4-acetylsulfanyl-1,2-dihydroxybutyl)-1,3-thiazole-4-carboxylate (PubChem CID 171876320) has the molecular formula C12H17NO5S2 and a molecular weight of 319.40 g/mol. Its IUPAC name is ethyl 2-(4-acetylsulfanyl-1,2-dihydroxybutyl)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-(4-acetylsulfanyl-1,2-dihydroxybutyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 171876320 |
| Molecular Formula | C12H17NO5S2 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | ethyl 2-(4-acetylsulfanyl-1,2-dihydroxybutyl)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(C(O)C(O)CCSC(C)=O)n1 |
| InChI | InChI=1S/C12H17NO5S2/c1-3-18-12(17)8-6-20-11(13-8)10(16)9(15)4-5-19-7(2)14/h6,9-10,15-16H,3-5H2,1-2H3 |
| InChIKey | RQVQLAJMBMSQOY-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|