About 4-(4-acetylsulfanyl-1,2-dihydroxybutyl)-1,3-thiazole-2-carboxylate
4-(4-acetylsulfanyl-1,2-dihydroxybutyl)-1,3-thiazole-2-carboxylate (PubChem CID 171875645) has the molecular formula C10H12NO5S2-
and a molecular weight of 290.34 g/mol. Its IUPAC name is 4-(4-acetylsulfanyl-1,2-dihydroxybutyl)-1,3-thiazole-2-carboxylate.
Molecular Properties
| Compound Name | 4-(4-acetylsulfanyl-1,2-dihydroxybutyl)-1,3-thiazole-2-carboxylate |
| PubChem CID | 171875645 |
| Molecular Formula | C10H12NO5S2- |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 4-(4-acetylsulfanyl-1,2-dihydroxybutyl)-1,3-thiazole-2-carboxylate |
| SMILES | CC(=O)SCCC(O)C(O)c1csc(C(=O)[O-])n1 |
| InChI | InChI=1S/C10H13NO5S2/c1-5(12)17-3-2-7(13)8(14)6-4-18-9(11-6)10(15)16/h4,7-8,13-14H,2-3H2,1H3,(H,15,16)/p-1 |
| InChIKey | DQXSNZBHDNOBPO-UHFFFAOYSA-M |
| XLogP | -0.43 |
| TPSA | 110.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-acetylsulfanyl-1,2-dihydroxybutyl)-1,3-thiazole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-acetylsulfanyl-1,2-dihydroxybutyl)-1,3-thiazole-2-carboxylate?
The IUPAC name of 4-(4-acetylsulfanyl-1,2-dihydroxybutyl)-1,3-thiazole-2-carboxylate (CID 171875645) is 4-(4-acetylsulfanyl-1,2-dihydroxybutyl)-1,3-thiazole-2-carboxylate.
What is the SMILES notation for 4-(4-acetylsulfanyl-1,2-dihydroxybutyl)-1,3-thiazole-2-carboxylate?
The canonical SMILES for 4-(4-acetylsulfanyl-1,2-dihydroxybutyl)-1,3-thiazole-2-carboxylate is CC(=O)SCCC(O)C(O)c1csc(C(=O)[O-])n1.
What is the InChIKey of 4-(4-acetylsulfanyl-1,2-dihydroxybutyl)-1,3-thiazole-2-carboxylate?
The InChIKey is DQXSNZBHDNOBPO-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H13NO5S2/c1-5(12)17-3-2-7(13)8(14)6-4-18-9(11-6)10(15)16/h4,7-8,13-14H,2-3H2,1H3,(H,15,16)/p-1.
What are the key properties of 4-(4-acetylsulfanyl-1,2-dihydroxybutyl)-1,3-thiazole-2-carboxylate?
4-(4-acetylsulfanyl-1,2-dihydroxybutyl)-1,3-thiazole-2-carboxylate has a molecular weight of 290.34 g/mol, XLogP of -0.43, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-acetylsulfanyl-1,2-dihydroxybutyl)-1,3-thiazole-2-carboxylate is sourced from PubChem (CID 171875645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).