C9H10O3S — CID 157047306
5-[1-(hydroxymethyl)cyclopropyl]thiophene-3-carboxylic acid (PubChem CID 157047306) has the molecular formula C9H10O3S and a molecular weight of 198.24 g/mol. Its IUPAC name is 5-[1-(hydroxymethyl)cyclopropyl]thiophene-3-carboxylic acid.
| Compound Name | 5-[1-(hydroxymethyl)cyclopropyl]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 157047306 |
| Molecular Formula | C9H10O3S |
| Molecular Weight | 198.24 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | 5-[1-(hydroxymethyl)cyclopropyl]thiophene-3-carboxylic acid |
| SMILES | O=C(O)c1csc(C2(CO)CC2)c1 |
| InChI | InChI=1S/C9H10O3S/c10-5-9(1-2-9)7-3-6(4-13-7)8(11)12/h3-4,10H,1-2,5H2,(H,11,12) |
| InChIKey | YOCSEASOWTVFEI-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.24 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |