C10H10O4S — CID 90285447
5-(1-methoxycarbonylcyclopropyl)thiophene-3-carboxylic acid (PubChem CID 90285447) has the molecular formula C10H10O4S and a molecular weight of 226.25 g/mol. Its IUPAC name is 5-(1-methoxycarbonylcyclopropyl)thiophene-3-carboxylic acid.
| Compound Name | 5-(1-methoxycarbonylcyclopropyl)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 90285447 |
| Molecular Formula | C10H10O4S |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | 5-(1-methoxycarbonylcyclopropyl)thiophene-3-carboxylic acid |
| SMILES | COC(=O)C1(c2cc(C(=O)O)cs2)CC1 |
| InChI | InChI=1S/C10H10O4S/c1-14-9(13)10(2-3-10)7-4-6(5-15-7)8(11)12/h4-5H,2-3H2,1H3,(H,11,12) |
| InChIKey | RABZBAUUSUNSLA-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |