5-(4,5-dimethoxy-2-methylphenyl)thiophene-3-carboxylic acid

C14H14O4S — CID 98021688

IUPAC5-(4,5-dimethoxy-2-methylphenyl)thiophene-3-carboxylic acid
SMILESCOc1cc(C)c(-c2cc(C(=O)O)cs2)cc1OC
InChIInChI=1S/C14H14O4S/c1-8-4-11(17-2)12(18-3)6-10(8)13-5-9(7-19-13)14(15)16/h4-7H,1-3H3,(H,15,16)
InChIKeyDNFCDDJDFIUNRB-UHFFFAOYSA-N
MW278.33 g/mol
LogP3.44
Rot. Bonds4

About 5-(4,5-dimethoxy-2-methylphenyl)thiophene-3-carboxylic acid

5-(4,5-dimethoxy-2-methylphenyl)thiophene-3-carboxylic acid (PubChem CID 98021688) has the molecular formula C14H14O4S and a molecular weight of 278.33 g/mol. Its IUPAC name is 5-(4,5-dimethoxy-2-methylphenyl)thiophene-3-carboxylic acid.

Molecular Properties

Compound Name5-(4,5-dimethoxy-2-methylphenyl)thiophene-3-carboxylic acid
PubChem CID98021688
Molecular FormulaC14H14O4S
Molecular Weight278.33 g/mol
Exact Mass278.06
IUPAC Name5-(4,5-dimethoxy-2-methylphenyl)thiophene-3-carboxylic acid
SMILESCOc1cc(C)c(-c2cc(C(=O)O)cs2)cc1OC
InChIInChI=1S/C14H14O4S/c1-8-4-11(17-2)12(18-3)6-10(8)13-5-9(7-19-13)14(15)16/h4-7H,1-3H3,(H,15,16)
InChIKeyDNFCDDJDFIUNRB-UHFFFAOYSA-N
XLogP3.44
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500278.33
LogP ≤ 53.44
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 5-(4,5-dimethoxy-2-methylphenyl)thiophene-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(4,5-dimethoxy-2-methylphenyl)thiophene-3-carboxylic acid?
The IUPAC name of 5-(4,5-dimethoxy-2-methylphenyl)thiophene-3-carboxylic acid (CID 98021688) is 5-(4,5-dimethoxy-2-methylphenyl)thiophene-3-carboxylic acid.
What is the SMILES notation for 5-(4,5-dimethoxy-2-methylphenyl)thiophene-3-carboxylic acid?
The canonical SMILES for 5-(4,5-dimethoxy-2-methylphenyl)thiophene-3-carboxylic acid is COc1cc(C)c(-c2cc(C(=O)O)cs2)cc1OC.
What is the InChIKey of 5-(4,5-dimethoxy-2-methylphenyl)thiophene-3-carboxylic acid?
The InChIKey is DNFCDDJDFIUNRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O4S/c1-8-4-11(17-2)12(18-3)6-10(8)13-5-9(7-19-13)14(15)16/h4-7H,1-3H3,(H,15,16).
What are the key properties of 5-(4,5-dimethoxy-2-methylphenyl)thiophene-3-carboxylic acid?
5-(4,5-dimethoxy-2-methylphenyl)thiophene-3-carboxylic acid has a molecular weight of 278.33 g/mol, XLogP of 3.44, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4,5-dimethoxy-2-methylphenyl)thiophene-3-carboxylic acid is sourced from PubChem (CID 98021688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).