C14H14O4S — CID 98021688
5-(4,5-dimethoxy-2-methylphenyl)thiophene-3-carboxylic acid (PubChem CID 98021688) has the molecular formula C14H14O4S and a molecular weight of 278.33 g/mol. Its IUPAC name is 5-(4,5-dimethoxy-2-methylphenyl)thiophene-3-carboxylic acid.
| Compound Name | 5-(4,5-dimethoxy-2-methylphenyl)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 98021688 |
| Molecular Formula | C14H14O4S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 5-(4,5-dimethoxy-2-methylphenyl)thiophene-3-carboxylic acid |
| SMILES | COc1cc(C)c(-c2cc(C(=O)O)cs2)cc1OC |
| InChI | InChI=1S/C14H14O4S/c1-8-4-11(17-2)12(18-3)6-10(8)13-5-9(7-19-13)14(15)16/h4-7H,1-3H3,(H,15,16) |
| InChIKey | DNFCDDJDFIUNRB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |