C20H22O8 — CID 101351133
2-[5-[5-(carboxymethoxy)-4-methoxy-2-methylphenyl]-2-methoxy-4-methylphenoxy]acetic acid (PubChem CID 101351133) has the molecular formula C20H22O8 and a molecular weight of 390.39 g/mol. Its IUPAC name is 2-[5-[5-(carboxymethoxy)-4-methoxy-2-methylphenyl]-2-methoxy-4-methylphenoxy]acetic acid.
| Compound Name | 2-[5-[5-(carboxymethoxy)-4-methoxy-2-methylphenyl]-2-methoxy-4-methylphenoxy]acetic acid |
|---|---|
| PubChem CID | 101351133 |
| Molecular Formula | C20H22O8 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 2-[5-[5-(carboxymethoxy)-4-methoxy-2-methylphenyl]-2-methoxy-4-methylphenoxy]acetic acid |
| SMILES | COc1cc(C)c(-c2cc(OCC(=O)O)c(OC)cc2C)cc1OCC(=O)O |
| InChI | InChI=1S/C20H22O8/c1-11-5-15(25-3)17(27-9-19(21)22)7-13(11)14-8-18(28-10-20(23)24)16(26-4)6-12(14)2/h5-8H,9-10H2,1-4H3,(H,21,22)(H,23,24) |
| InChIKey | CWCMRQNGNQMLDA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |