C10H9ClO5 — CID 19575264
2-(5-chloro-4-formyl-2-methoxyphenoxy)acetic acid (PubChem CID 19575264) has the molecular formula C10H9ClO5 and a molecular weight of 244.63 g/mol. Its IUPAC name is 2-(5-chloro-4-formyl-2-methoxyphenoxy)acetic acid.
| Compound Name | 2-(5-chloro-4-formyl-2-methoxyphenoxy)acetic acid |
|---|---|
| PubChem CID | 19575264 |
| Molecular Formula | C10H9ClO5 |
| Molecular Weight | 244.63 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | 2-(5-chloro-4-formyl-2-methoxyphenoxy)acetic acid |
| SMILES | COc1cc(C=O)c(Cl)cc1OCC(=O)O |
| InChI | InChI=1S/C10H9ClO5/c1-15-8-2-6(4-12)7(11)3-9(8)16-5-10(13)14/h2-4H,5H2,1H3,(H,13,14) |
| InChIKey | LNHVLHKQMJQEHS-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.63 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|