C16H15ClO3 — CID 107989851
4-chloro-3-(4-methoxy-2,5-dimethylphenyl)benzoic acid (PubChem CID 107989851) has the molecular formula C16H15ClO3 and a molecular weight of 290.75 g/mol. Its IUPAC name is 4-chloro-3-(4-methoxy-2,5-dimethylphenyl)benzoic acid.
| Compound Name | 4-chloro-3-(4-methoxy-2,5-dimethylphenyl)benzoic acid |
|---|---|
| PubChem CID | 107989851 |
| Molecular Formula | C16H15ClO3 |
| Molecular Weight | 290.75 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 4-chloro-3-(4-methoxy-2,5-dimethylphenyl)benzoic acid |
| SMILES | COc1cc(C)c(-c2cc(C(=O)O)ccc2Cl)cc1C |
| InChI | InChI=1S/C16H15ClO3/c1-9-7-15(20-3)10(2)6-12(9)13-8-11(16(18)19)4-5-14(13)17/h4-8H,1-3H3,(H,18,19) |
| InChIKey | ASYWIHCTEQEWLV-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.75 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |