4-chloro-3-(4-methoxy-2,5-dimethylphenyl)benzoic acid

C16H15ClO3 — CID 107989851

IUPAC4-chloro-3-(4-methoxy-2,5-dimethylphenyl)benzoic acid
SMILESCOc1cc(C)c(-c2cc(C(=O)O)ccc2Cl)cc1C
InChIInChI=1S/C16H15ClO3/c1-9-7-15(20-3)10(2)6-12(9)13-8-11(16(18)19)4-5-14(13)17/h4-8H,1-3H3,(H,18,19)
InChIKeyASYWIHCTEQEWLV-UHFFFAOYSA-N
MW290.75 g/mol
LogP4.33
Rot. Bonds3

About 4-chloro-3-(4-methoxy-2,5-dimethylphenyl)benzoic acid

4-chloro-3-(4-methoxy-2,5-dimethylphenyl)benzoic acid (PubChem CID 107989851) has the molecular formula C16H15ClO3 and a molecular weight of 290.75 g/mol. Its IUPAC name is 4-chloro-3-(4-methoxy-2,5-dimethylphenyl)benzoic acid.

Molecular Properties

Compound Name4-chloro-3-(4-methoxy-2,5-dimethylphenyl)benzoic acid
PubChem CID107989851
Molecular FormulaC16H15ClO3
Molecular Weight290.75 g/mol
Exact Mass290.07
IUPAC Name4-chloro-3-(4-methoxy-2,5-dimethylphenyl)benzoic acid
SMILESCOc1cc(C)c(-c2cc(C(=O)O)ccc2Cl)cc1C
InChIInChI=1S/C16H15ClO3/c1-9-7-15(20-3)10(2)6-12(9)13-8-11(16(18)19)4-5-14(13)17/h4-8H,1-3H3,(H,18,19)
InChIKeyASYWIHCTEQEWLV-UHFFFAOYSA-N
XLogP4.33
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500290.75
LogP ≤ 54.33
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4-chloro-3-(4-methoxy-2,5-dimethylphenyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-chloro-3-(4-methoxy-2,5-dimethylphenyl)benzoic acid?
The IUPAC name of 4-chloro-3-(4-methoxy-2,5-dimethylphenyl)benzoic acid (CID 107989851) is 4-chloro-3-(4-methoxy-2,5-dimethylphenyl)benzoic acid.
What is the SMILES notation for 4-chloro-3-(4-methoxy-2,5-dimethylphenyl)benzoic acid?
The canonical SMILES for 4-chloro-3-(4-methoxy-2,5-dimethylphenyl)benzoic acid is COc1cc(C)c(-c2cc(C(=O)O)ccc2Cl)cc1C.
What is the InChIKey of 4-chloro-3-(4-methoxy-2,5-dimethylphenyl)benzoic acid?
The InChIKey is ASYWIHCTEQEWLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15ClO3/c1-9-7-15(20-3)10(2)6-12(9)13-8-11(16(18)19)4-5-14(13)17/h4-8H,1-3H3,(H,18,19).
What are the key properties of 4-chloro-3-(4-methoxy-2,5-dimethylphenyl)benzoic acid?
4-chloro-3-(4-methoxy-2,5-dimethylphenyl)benzoic acid has a molecular weight of 290.75 g/mol, XLogP of 4.33, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-(4-methoxy-2,5-dimethylphenyl)benzoic acid is sourced from PubChem (CID 107989851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).