C16H14Cl2O3 — CID 107515861
5-(2,5-dichloro-4-methoxyphenyl)-2,4-dimethylbenzoic acid (PubChem CID 107515861) has the molecular formula C16H14Cl2O3 and a molecular weight of 325.19 g/mol. Its IUPAC name is 5-(2,5-dichloro-4-methoxyphenyl)-2,4-dimethylbenzoic acid.
| Compound Name | 5-(2,5-dichloro-4-methoxyphenyl)-2,4-dimethylbenzoic acid |
|---|---|
| PubChem CID | 107515861 |
| Molecular Formula | C16H14Cl2O3 |
| Molecular Weight | 325.19 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 5-(2,5-dichloro-4-methoxyphenyl)-2,4-dimethylbenzoic acid |
| SMILES | COc1cc(Cl)c(-c2cc(C(=O)O)c(C)cc2C)cc1Cl |
| InChI | InChI=1S/C16H14Cl2O3/c1-8-4-9(2)11(16(19)20)5-10(8)12-6-14(18)15(21-3)7-13(12)17/h4-7H,1-3H3,(H,19,20) |
| InChIKey | WAOQSXCICTXLFE-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.19 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |