C11H13ClO5 — CID 171862643
3-(3-chloro-1,2-dihydroxypropyl)-5-methoxybenzoic acid (PubChem CID 171862643) has the molecular formula C11H13ClO5 and a molecular weight of 260.67 g/mol. Its IUPAC name is 3-(3-chloro-1,2-dihydroxypropyl)-5-methoxybenzoic acid.
| Compound Name | 3-(3-chloro-1,2-dihydroxypropyl)-5-methoxybenzoic acid |
|---|---|
| PubChem CID | 171862643 |
| Molecular Formula | C11H13ClO5 |
| Molecular Weight | 260.67 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 3-(3-chloro-1,2-dihydroxypropyl)-5-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)cc(C(O)C(O)CCl)c1 |
| InChI | InChI=1S/C11H13ClO5/c1-17-8-3-6(10(14)9(13)5-12)2-7(4-8)11(15)16/h2-4,9-10,13-14H,5H2,1H3,(H,15,16) |
| InChIKey | WBRHYXNLQYNIRU-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.67 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|