C12H15ClO4 — CID 171862598
4-(3-chloro-1,2-dihydroxypropyl)-2,6-dimethylbenzoic acid (PubChem CID 171862598) has the molecular formula C12H15ClO4 and a molecular weight of 258.70 g/mol. Its IUPAC name is 4-(3-chloro-1,2-dihydroxypropyl)-2,6-dimethylbenzoic acid.
| Compound Name | 4-(3-chloro-1,2-dihydroxypropyl)-2,6-dimethylbenzoic acid |
|---|---|
| PubChem CID | 171862598 |
| Molecular Formula | C12H15ClO4 |
| Molecular Weight | 258.70 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 4-(3-chloro-1,2-dihydroxypropyl)-2,6-dimethylbenzoic acid |
| SMILES | Cc1cc(C(O)C(O)CCl)cc(C)c1C(=O)O |
| InChI | InChI=1S/C12H15ClO4/c1-6-3-8(11(15)9(14)5-13)4-7(2)10(6)12(16)17/h3-4,9,11,14-15H,5H2,1-2H3,(H,16,17) |
| InChIKey | INFIDOBDLNLKGP-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.70 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|