C13H19ClO2 — CID 171863166
3-chloro-1-(2,3,5,6-tetramethylphenyl)propane-1,2-diol (PubChem CID 171863166) has the molecular formula C13H19ClO2 and a molecular weight of 242.75 g/mol. Its IUPAC name is 3-chloro-1-(2,3,5,6-tetramethylphenyl)propane-1,2-diol.
| Compound Name | 3-chloro-1-(2,3,5,6-tetramethylphenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 171863166 |
| Molecular Formula | C13H19ClO2 |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 3-chloro-1-(2,3,5,6-tetramethylphenyl)propane-1,2-diol |
| SMILES | Cc1cc(C)c(C)c(C(O)C(O)CCl)c1C |
| InChI | InChI=1S/C13H19ClO2/c1-7-5-8(2)10(4)12(9(7)3)13(16)11(15)6-14/h5,11,13,15-16H,6H2,1-4H3 |
| InChIKey | VPJUUYPMBFHVIT-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|