C10H13ClO3 — CID 171861659
3-chloro-1-(2-hydroxy-6-methylphenyl)propane-1,2-diol (PubChem CID 171861659) has the molecular formula C10H13ClO3 and a molecular weight of 216.66 g/mol. Its IUPAC name is 3-chloro-1-(2-hydroxy-6-methylphenyl)propane-1,2-diol.
| Compound Name | 3-chloro-1-(2-hydroxy-6-methylphenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 171861659 |
| Molecular Formula | C10H13ClO3 |
| Molecular Weight | 216.66 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 3-chloro-1-(2-hydroxy-6-methylphenyl)propane-1,2-diol |
| SMILES | Cc1cccc(O)c1C(O)C(O)CCl |
| InChI | InChI=1S/C10H13ClO3/c1-6-3-2-4-7(12)9(6)10(14)8(13)5-11/h2-4,8,10,12-14H,5H2,1H3 |
| InChIKey | VAIGKABGEXSHQG-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.66 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|