C8H13ClN2O2 — CID 171861478
3-chloro-1-(3,5-dimethyl-1H-pyrazol-4-yl)propane-1,2-diol (PubChem CID 171861478) has the molecular formula C8H13ClN2O2 and a molecular weight of 204.66 g/mol. Its IUPAC name is 3-chloro-1-(3,5-dimethyl-1H-pyrazol-4-yl)propane-1,2-diol.
| Compound Name | 3-chloro-1-(3,5-dimethyl-1H-pyrazol-4-yl)propane-1,2-diol |
|---|---|
| PubChem CID | 171861478 |
| Molecular Formula | C8H13ClN2O2 |
| Molecular Weight | 204.66 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 3-chloro-1-(3,5-dimethyl-1H-pyrazol-4-yl)propane-1,2-diol |
| SMILES | Cc1n[nH]c(C)c1C(O)C(O)CCl |
| InChI | InChI=1S/C8H13ClN2O2/c1-4-7(5(2)11-10-4)8(13)6(12)3-9/h6,8,12-13H,3H2,1-2H3,(H,10,11) |
| InChIKey | MZLIPZKNNJGSEC-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.66 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|