C12H16N3+ — CID 7219711
[(S)-(3,5-dimethyl-1H-pyrazol-4-yl)-phenylmethyl]azanium (PubChem CID 7219711) has the molecular formula C12H16N3+ and a molecular weight of 202.28 g/mol. Its IUPAC name is [(S)-(3,5-dimethyl-1H-pyrazol-4-yl)-phenylmethyl]azanium.
| Compound Name | [(S)-(3,5-dimethyl-1H-pyrazol-4-yl)-phenylmethyl]azanium |
|---|---|
| PubChem CID | 7219711 |
| Molecular Formula | C12H16N3+ |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | [(S)-(3,5-dimethyl-1H-pyrazol-4-yl)-phenylmethyl]azanium |
| SMILES | Cc1n[nH]c(C)c1[C@@H]([NH3+])c1ccccc1 |
| InChI | InChI=1S/C12H15N3/c1-8-11(9(2)15-14-8)12(13)10-6-4-3-5-7-10/h3-7,12H,13H2,1-2H3,(H,14,15)/p+1/t12-/m0/s1 |
| InChIKey | CGCLUEUNHMVTPB-LBPRGKRZSA-O |
| XLogP | 1.36 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |