C15H21N5Si — CID 10063342
[benzotriazol-1-yl-(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-trimethylsilane (PubChem CID 10063342) has the molecular formula C15H21N5Si and a molecular weight of 299.45 g/mol. Its IUPAC name is [benzotriazol-1-yl-(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-trimethylsilane.
| Compound Name | [benzotriazol-1-yl-(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-trimethylsilane |
|---|---|
| PubChem CID | 10063342 |
| Molecular Formula | C15H21N5Si |
| Molecular Weight | 299.45 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | [benzotriazol-1-yl-(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-trimethylsilane |
| SMILES | Cc1n[nH]c(C)c1C(n1nnc2ccccc21)[Si](C)(C)C |
| InChI | InChI=1S/C15H21N5Si/c1-10-14(11(2)17-16-10)15(21(3,4)5)20-13-9-7-6-8-12(13)18-19-20/h6-9,15H,1-5H3,(H,16,17) |
| InChIKey | MPLCCAXDPAFKOG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.45 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|