C18H24N4Si — CID 3784942
4-[benzotriazol-1-yl(trimethylsilyl)methyl]-N,N-dimethylaniline (PubChem CID 3784942) has the molecular formula C18H24N4Si and a molecular weight of 324.50 g/mol. Its IUPAC name is 4-[benzotriazol-1-yl(trimethylsilyl)methyl]-N,N-dimethylaniline.
| Compound Name | 4-[benzotriazol-1-yl(trimethylsilyl)methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 3784942 |
| Molecular Formula | C18H24N4Si |
| Molecular Weight | 324.50 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 4-[benzotriazol-1-yl(trimethylsilyl)methyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C(n2nnc3ccccc32)[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C18H24N4Si/c1-21(2)15-12-10-14(11-13-15)18(23(3,4)5)22-17-9-7-6-8-16(17)19-20-22/h6-13,18H,1-5H3 |
| InChIKey | KGSMLGYSMVGTSO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.50 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|