C8H12N2O3S — CID 170819564
1-(2-methoxypyrimidin-5-yl)-3-sulfanylpropane-1,2-diol (PubChem CID 170819564) has the molecular formula C8H12N2O3S and a molecular weight of 216.26 g/mol. Its IUPAC name is 1-(2-methoxypyrimidin-5-yl)-3-sulfanylpropane-1,2-diol.
| Compound Name | 1-(2-methoxypyrimidin-5-yl)-3-sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 170819564 |
| Molecular Formula | C8H12N2O3S |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 1-(2-methoxypyrimidin-5-yl)-3-sulfanylpropane-1,2-diol |
| SMILES | COc1ncc(C(O)C(O)CS)cn1 |
| InChI | InChI=1S/C8H12N2O3S/c1-13-8-9-2-5(3-10-8)7(12)6(11)4-14/h2-3,6-7,11-12,14H,4H2,1H3 |
| InChIKey | IKYXZOMWBFSDFP-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 75.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|