C9H11NO3S — CID 170819648
5-(1,2-dihydroxy-3-sulfanylpropyl)pyridine-2-carbaldehyde (PubChem CID 170819648) has the molecular formula C9H11NO3S and a molecular weight of 213.26 g/mol. Its IUPAC name is 5-(1,2-dihydroxy-3-sulfanylpropyl)pyridine-2-carbaldehyde.
| Compound Name | 5-(1,2-dihydroxy-3-sulfanylpropyl)pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 170819648 |
| Molecular Formula | C9H11NO3S |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.05 |
| IUPAC Name | 5-(1,2-dihydroxy-3-sulfanylpropyl)pyridine-2-carbaldehyde |
| SMILES | O=Cc1ccc(C(O)C(O)CS)cn1 |
| InChI | InChI=1S/C9H11NO3S/c11-4-7-2-1-6(3-10-7)9(13)8(12)5-14/h1-4,8-9,12-14H,5H2 |
| InChIKey | IRPJWBISKMVOOC-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|