C10H10N2O3 — CID 171900738
4-(6-formyl-3-pyridinyl)-3,4-dihydroxybutanenitrile (PubChem CID 171900738) has the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. Its IUPAC name is 4-(6-formyl-3-pyridinyl)-3,4-dihydroxybutanenitrile.
| Compound Name | 4-(6-formyl-3-pyridinyl)-3,4-dihydroxybutanenitrile |
|---|---|
| PubChem CID | 171900738 |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 4-(6-formyl-3-pyridinyl)-3,4-dihydroxybutanenitrile |
| SMILES | N#CCC(O)C(O)c1ccc(C=O)nc1 |
| InChI | InChI=1S/C10H10N2O3/c11-4-3-9(14)10(15)7-1-2-8(6-13)12-5-7/h1-2,5-6,9-10,14-15H,3H2 |
| InChIKey | JMQMVBAUIPSSGN-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 94.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|