C16H18O3S — CID 170821073
1-[4-(2-methoxyphenyl)phenyl]-3-sulfanylpropane-1,2-diol (PubChem CID 170821073) has the molecular formula C16H18O3S and a molecular weight of 290.38 g/mol. Its IUPAC name is 1-[4-(2-methoxyphenyl)phenyl]-3-sulfanylpropane-1,2-diol.
| Compound Name | 1-[4-(2-methoxyphenyl)phenyl]-3-sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 170821073 |
| Molecular Formula | C16H18O3S |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 1-[4-(2-methoxyphenyl)phenyl]-3-sulfanylpropane-1,2-diol |
| SMILES | COc1ccccc1-c1ccc(C(O)C(O)CS)cc1 |
| InChI | InChI=1S/C16H18O3S/c1-19-15-5-3-2-4-13(15)11-6-8-12(9-7-11)16(18)14(17)10-20/h2-9,14,16-18,20H,10H2,1H3 |
| InChIKey | DHQBKPSJVKCZSC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|