C16H17ClO3 — CID 171863230
3-chloro-1-[4-(2-methoxyphenyl)phenyl]propane-1,2-diol (PubChem CID 171863230) has the molecular formula C16H17ClO3 and a molecular weight of 292.76 g/mol. Its IUPAC name is 3-chloro-1-[4-(2-methoxyphenyl)phenyl]propane-1,2-diol.
| Compound Name | 3-chloro-1-[4-(2-methoxyphenyl)phenyl]propane-1,2-diol |
|---|---|
| PubChem CID | 171863230 |
| Molecular Formula | C16H17ClO3 |
| Molecular Weight | 292.76 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 3-chloro-1-[4-(2-methoxyphenyl)phenyl]propane-1,2-diol |
| SMILES | COc1ccccc1-c1ccc(C(O)C(O)CCl)cc1 |
| InChI | InChI=1S/C16H17ClO3/c1-20-15-5-3-2-4-13(15)11-6-8-12(9-7-11)16(19)14(18)10-17/h2-9,14,16,18-19H,10H2,1H3 |
| InChIKey | RIRGQVFPUPZAGV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.76 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|