C10H13ClO5 — CID 171863361
5-(3-chloro-1,2-dihydroxypropyl)-3-methoxybenzene-1,2-diol (PubChem CID 171863361) has the molecular formula C10H13ClO5 and a molecular weight of 248.66 g/mol. Its IUPAC name is 5-(3-chloro-1,2-dihydroxypropyl)-3-methoxybenzene-1,2-diol.
| Compound Name | 5-(3-chloro-1,2-dihydroxypropyl)-3-methoxybenzene-1,2-diol |
|---|---|
| PubChem CID | 171863361 |
| Molecular Formula | C10H13ClO5 |
| Molecular Weight | 248.66 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 5-(3-chloro-1,2-dihydroxypropyl)-3-methoxybenzene-1,2-diol |
| SMILES | COc1cc(C(O)C(O)CCl)cc(O)c1O |
| InChI | InChI=1S/C10H13ClO5/c1-16-8-3-5(2-6(12)10(8)15)9(14)7(13)4-11/h2-3,7,9,12-15H,4H2,1H3 |
| InChIKey | YEIUVTQNRPSDPY-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.66 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|