C10H10INO4 — CID 171871551
2,3-dihydroxy-3-(4-hydroxy-3-iodo-5-methoxyphenyl)propanenitrile (PubChem CID 171871551) has the molecular formula C10H10INO4 and a molecular weight of 335.10 g/mol. Its IUPAC name is 2,3-dihydroxy-3-(4-hydroxy-3-iodo-5-methoxyphenyl)propanenitrile.
| Compound Name | 2,3-dihydroxy-3-(4-hydroxy-3-iodo-5-methoxyphenyl)propanenitrile |
|---|---|
| PubChem CID | 171871551 |
| Molecular Formula | C10H10INO4 |
| Molecular Weight | 335.10 g/mol |
| Exact Mass | 334.97 |
| IUPAC Name | 2,3-dihydroxy-3-(4-hydroxy-3-iodo-5-methoxyphenyl)propanenitrile |
| SMILES | COc1cc(C(O)C(O)C#N)cc(I)c1O |
| InChI | InChI=1S/C10H10INO4/c1-16-8-3-5(2-6(11)10(8)15)9(14)7(13)4-12/h2-3,7,9,13-15H,1H3 |
| InChIKey | ONXJYZDBBLIUNQ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.10 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|