C11H16INO4 — CID 170829256
3-amino-1-(3-iodo-4,5-dimethoxyphenyl)propane-1,2-diol (PubChem CID 170829256) has the molecular formula C11H16INO4 and a molecular weight of 353.16 g/mol. Its IUPAC name is 3-amino-1-(3-iodo-4,5-dimethoxyphenyl)propane-1,2-diol.
| Compound Name | 3-amino-1-(3-iodo-4,5-dimethoxyphenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 170829256 |
| Molecular Formula | C11H16INO4 |
| Molecular Weight | 353.16 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | 3-amino-1-(3-iodo-4,5-dimethoxyphenyl)propane-1,2-diol |
| SMILES | COc1cc(C(O)C(O)CN)cc(I)c1OC |
| InChI | InChI=1S/C11H16INO4/c1-16-9-4-6(10(15)8(14)5-13)3-7(12)11(9)17-2/h3-4,8,10,14-15H,5,13H2,1-2H3 |
| InChIKey | MPDPLBRZXNTLEG-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.16 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|