C22H29IO8 — CID 18467385
1-[4-(1-hydroxyethoxy)-3-iodo-5-methoxyphenyl]-4-(3,4,5-trimethoxyphenyl)butane-1,4-diol (PubChem CID 18467385) has the molecular formula C22H29IO8 and a molecular weight of 548.37 g/mol. Its IUPAC name is 1-[4-(1-hydroxyethoxy)-3-iodo-5-methoxyphenyl]-4-(3,4,5-trimethoxyphenyl)butane-1,4-diol.
| Compound Name | 1-[4-(1-hydroxyethoxy)-3-iodo-5-methoxyphenyl]-4-(3,4,5-trimethoxyphenyl)butane-1,4-diol |
|---|---|
| PubChem CID | 18467385 |
| Molecular Formula | C22H29IO8 |
| Molecular Weight | 548.37 g/mol |
| Exact Mass | 548.09 |
| IUPAC Name | 1-[4-(1-hydroxyethoxy)-3-iodo-5-methoxyphenyl]-4-(3,4,5-trimethoxyphenyl)butane-1,4-diol |
| SMILES | COc1cc(C(O)CCC(O)c2cc(OC)c(OC)c(OC)c2)cc(I)c1OC(C)O |
| InChI | InChI=1S/C22H29IO8/c1-12(24)31-21-15(23)8-13(9-18(21)27-2)16(25)6-7-17(26)14-10-19(28-3)22(30-5)20(11-14)29-4/h8-12,16-17,24-26H,6-7H2,1-5H3 |
| InChIKey | JBBHAWAHRJAJHI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.37 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|