C14H19IO5 — CID 14828591
4-hydroxy-4-(3-iodo-5-methoxy-4-propoxyphenyl)butanoic acid (PubChem CID 14828591) has the molecular formula C14H19IO5 and a molecular weight of 394.21 g/mol. Its IUPAC name is 4-hydroxy-4-(3-iodo-5-methoxy-4-propoxyphenyl)butanoic acid.
| Compound Name | 4-hydroxy-4-(3-iodo-5-methoxy-4-propoxyphenyl)butanoic acid |
|---|---|
| PubChem CID | 14828591 |
| Molecular Formula | C14H19IO5 |
| Molecular Weight | 394.21 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | 4-hydroxy-4-(3-iodo-5-methoxy-4-propoxyphenyl)butanoic acid |
| SMILES | CCCOc1c(I)cc(C(O)CCC(=O)O)cc1OC |
| InChI | InChI=1S/C14H19IO5/c1-3-6-20-14-10(15)7-9(8-12(14)19-2)11(16)4-5-13(17)18/h7-8,11,16H,3-6H2,1-2H3,(H,17,18) |
| InChIKey | UMRZTNSNTXYDTJ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.21 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|