C11H14IN3O4 — CID 170827268
3-azido-1-(3-iodo-4,5-dimethoxyphenyl)propane-1,2-diol (PubChem CID 170827268) has the molecular formula C11H14IN3O4 and a molecular weight of 379.15 g/mol. Its IUPAC name is 3-azido-1-(3-iodo-4,5-dimethoxyphenyl)propane-1,2-diol.
| Compound Name | 3-azido-1-(3-iodo-4,5-dimethoxyphenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 170827268 |
| Molecular Formula | C11H14IN3O4 |
| Molecular Weight | 379.15 g/mol |
| Exact Mass | 379.00 |
| IUPAC Name | 3-azido-1-(3-iodo-4,5-dimethoxyphenyl)propane-1,2-diol |
| SMILES | COc1cc(C(O)C(O)CN=[N+]=[N-])cc(I)c1OC |
| InChI | InChI=1S/C11H14IN3O4/c1-18-9-4-6(3-7(12)11(9)19-2)10(17)8(16)5-14-15-13/h3-4,8,10,16-17H,5H2,1-2H3 |
| InChIKey | KCSARRUYYVLSII-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 107.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.15 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|